C20H29N7 — CID 126932911
2-(2-piperidin-1-ylethyl)-5-(6-pyrazol-1-ylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 126932911) has the molecular formula C20H29N7 and a molecular weight of 367.50 g/mol. Its IUPAC name is 2-(2-piperidin-1-ylethyl)-5-(6-pyrazol-1-ylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | 2-(2-piperidin-1-ylethyl)-5-(6-pyrazol-1-ylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 126932911 |
| Molecular Formula | C20H29N7 |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | 2-(2-piperidin-1-ylethyl)-5-(6-pyrazol-1-ylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | c1cnn(-c2cc(N3CC4CN(CCN5CCCCC5)CC4C3)ncn2)c1 |
| InChI | InChI=1S/C20H29N7/c1-2-6-24(7-3-1)9-10-25-12-17-14-26(15-18(17)13-25)19-11-20(22-16-21-19)27-8-4-5-23-27/h4-5,8,11,16-18H,1-3,6-7,9-10,12-15H2 |
| InChIKey | NXKULPFXBUDLIA-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 53.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |