C21H26N8 — CID 126933185
5-[6-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]-2-[(6-methylpyrazin-2-yl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 126933185) has the molecular formula C21H26N8 and a molecular weight of 390.50 g/mol. Its IUPAC name is 5-[6-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]-2-[(6-methylpyrazin-2-yl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | 5-[6-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]-2-[(6-methylpyrazin-2-yl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 126933185 |
| Molecular Formula | C21H26N8 |
| Molecular Weight | 390.50 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | 5-[6-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]-2-[(6-methylpyrazin-2-yl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | Cc1cncc(CN2CC3CN(c4cc(-n5nc(C)cc5C)ncn4)CC3C2)n1 |
| InChI | InChI=1S/C21H26N8/c1-14-4-16(3)29(26-14)21-5-20(23-13-24-21)28-10-17-8-27(9-18(17)11-28)12-19-7-22-6-15(2)25-19/h4-7,13,17-18H,8-12H2,1-3H3 |
| InChIKey | SYBAYQVPMRMNTH-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 75.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.50 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |