C19H25N7O — CID 126933336
[6-(dimethylamino)pyridazin-3-yl]-[2-(5,6-dimethylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone (PubChem CID 126933336) has the molecular formula C19H25N7O and a molecular weight of 367.46 g/mol. Its IUPAC name is [6-(dimethylamino)pyridazin-3-yl]-[2-(5,6-dimethylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone.
| Compound Name | [6-(dimethylamino)pyridazin-3-yl]-[2-(5,6-dimethylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone |
|---|---|
| PubChem CID | 126933336 |
| Molecular Formula | C19H25N7O |
| Molecular Weight | 367.46 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | [6-(dimethylamino)pyridazin-3-yl]-[2-(5,6-dimethylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone |
| SMILES | Cc1ncnc(N2CC3CN(C(=O)c4ccc(N(C)C)nn4)CC3C2)c1C |
| InChI | InChI=1S/C19H25N7O/c1-12-13(2)20-11-21-18(12)25-7-14-9-26(10-15(14)8-25)19(27)16-5-6-17(23-22-16)24(3)4/h5-6,11,14-15H,7-10H2,1-4H3 |
| InChIKey | PUKAZOUFNUXGFB-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 78.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.46 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |