C21H29N5S — CID 126933445
2-cyclopentyl-4-[[5-(5,6-dimethylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyl]-1,3-thiazole (PubChem CID 126933445) has the molecular formula C21H29N5S and a molecular weight of 383.57 g/mol. Its IUPAC name is 2-cyclopentyl-4-[[5-(5,6-dimethylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyl]-1,3-thiazole.
| Compound Name | 2-cyclopentyl-4-[[5-(5,6-dimethylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 126933445 |
| Molecular Formula | C21H29N5S |
| Molecular Weight | 383.57 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | 2-cyclopentyl-4-[[5-(5,6-dimethylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyl]-1,3-thiazole |
| SMILES | Cc1ncnc(N2CC3CN(Cc4csc(C5CCCC5)n4)CC3C2)c1C |
| InChI | InChI=1S/C21H29N5S/c1-14-15(2)22-13-23-20(14)26-9-17-7-25(8-18(17)10-26)11-19-12-27-21(24-19)16-5-3-4-6-16/h12-13,16-18H,3-11H2,1-2H3 |
| InChIKey | XZBODYUQSDAFCC-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.57 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |