C18H21N9 — CID 126933592
5-(5,6-dimethylpyrimidin-4-yl)-2-[6-(1,2,4-triazol-1-yl)pyrazin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 126933592) has the molecular formula C18H21N9 and a molecular weight of 363.43 g/mol. Its IUPAC name is 5-(5,6-dimethylpyrimidin-4-yl)-2-[6-(1,2,4-triazol-1-yl)pyrazin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | 5-(5,6-dimethylpyrimidin-4-yl)-2-[6-(1,2,4-triazol-1-yl)pyrazin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 126933592 |
| Molecular Formula | C18H21N9 |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | 5-(5,6-dimethylpyrimidin-4-yl)-2-[6-(1,2,4-triazol-1-yl)pyrazin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | Cc1ncnc(N2CC3CN(c4cncc(-n5cncn5)n4)CC3C2)c1C |
| InChI | InChI=1S/C18H21N9/c1-12-13(2)21-10-22-18(12)26-7-14-5-25(6-15(14)8-26)16-3-19-4-17(24-16)27-11-20-9-23-27/h3-4,9-11,14-15H,5-8H2,1-2H3 |
| InChIKey | AYNUSLNWCZLXND-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 88.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |