About N-[4-(3-oxo-6,7-dihydro-5H-cyclopenta[c]pyridazin-2-yl)cyclohexyl]morpholine-4-sulfonamide
N-[4-(3-oxo-6,7-dihydro-5H-cyclopenta[c]pyridazin-2-yl)cyclohexyl]morpholine-4-sulfonamide (PubChem CID 126935361) has the molecular formula C17H26N4O4S
and a molecular weight of 382.49 g/mol. Its IUPAC name is N-[4-(3-oxo-6,7-dihydro-5H-cyclopenta[c]pyridazin-2-yl)cyclohexyl]morpholine-4-sulfonamide.
Molecular Properties
| Compound Name | N-[4-(3-oxo-6,7-dihydro-5H-cyclopenta[c]pyridazin-2-yl)cyclohexyl]morpholine-4-sulfonamide |
| PubChem CID | 126935361 |
| Molecular Formula | C17H26N4O4S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | N-[4-(3-oxo-6,7-dihydro-5H-cyclopenta[c]pyridazin-2-yl)cyclohexyl]morpholine-4-sulfonamide |
| SMILES | O=c1cc2c(nn1C1CCC(NS(=O)(=O)N3CCOCC3)CC1)CCC2 |
| InChI | InChI=1S/C17H26N4O4S/c22-17-12-13-2-1-3-16(13)18-21(17)15-6-4-14(5-7-15)19-26(23,24)20-8-10-25-11-9-20/h12,14-15,19H,1-11H2 |
| InChIKey | MDRAAIRTYLJQNH-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[4-(3-oxo-6,7-dihydro-5H-cyclopenta[c]pyridazin-2-yl)cyclohexyl]morpholine-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(3-oxo-6,7-dihydro-5H-cyclopenta[c]pyridazin-2-yl)cyclohexyl]morpholine-4-sulfonamide?
The IUPAC name of N-[4-(3-oxo-6,7-dihydro-5H-cyclopenta[c]pyridazin-2-yl)cyclohexyl]morpholine-4-sulfonamide (CID 126935361) is N-[4-(3-oxo-6,7-dihydro-5H-cyclopenta[c]pyridazin-2-yl)cyclohexyl]morpholine-4-sulfonamide.
What is the SMILES notation for N-[4-(3-oxo-6,7-dihydro-5H-cyclopenta[c]pyridazin-2-yl)cyclohexyl]morpholine-4-sulfonamide?
The canonical SMILES for N-[4-(3-oxo-6,7-dihydro-5H-cyclopenta[c]pyridazin-2-yl)cyclohexyl]morpholine-4-sulfonamide is O=c1cc2c(nn1C1CCC(NS(=O)(=O)N3CCOCC3)CC1)CCC2.
What is the InChIKey of N-[4-(3-oxo-6,7-dihydro-5H-cyclopenta[c]pyridazin-2-yl)cyclohexyl]morpholine-4-sulfonamide?
The InChIKey is MDRAAIRTYLJQNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N4O4S/c22-17-12-13-2-1-3-16(13)18-21(17)15-6-4-14(5-7-15)19-26(23,24)20-8-10-25-11-9-20/h12,14-15,19H,1-11H2.
What are the key properties of N-[4-(3-oxo-6,7-dihydro-5H-cyclopenta[c]pyridazin-2-yl)cyclohexyl]morpholine-4-sulfonamide?
N-[4-(3-oxo-6,7-dihydro-5H-cyclopenta[c]pyridazin-2-yl)cyclohexyl]morpholine-4-sulfonamide has a molecular weight of 382.49 g/mol, XLogP of 0.38, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(3-oxo-6,7-dihydro-5H-cyclopenta[c]pyridazin-2-yl)cyclohexyl]morpholine-4-sulfonamide is sourced from PubChem (CID 126935361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).