C22H27N7O2 — CID 126935642
5,7-dimethyl-N-[4-(3-oxo-5,6,7,8-tetrahydrocinnolin-2-yl)cyclohexyl]-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 126935642) has the molecular formula C22H27N7O2 and a molecular weight of 421.51 g/mol. Its IUPAC name is 5,7-dimethyl-N-[4-(3-oxo-5,6,7,8-tetrahydrocinnolin-2-yl)cyclohexyl]-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | 5,7-dimethyl-N-[4-(3-oxo-5,6,7,8-tetrahydrocinnolin-2-yl)cyclohexyl]-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 126935642 |
| Molecular Formula | C22H27N7O2 |
| Molecular Weight | 421.51 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | 5,7-dimethyl-N-[4-(3-oxo-5,6,7,8-tetrahydrocinnolin-2-yl)cyclohexyl]-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | Cc1cc(C)n2nc(C(=O)NC3CCC(n4nc5c(cc4=O)CCCC5)CC3)nc2n1 |
| InChI | InChI=1S/C22H27N7O2/c1-13-11-14(2)28-22(23-13)25-20(27-28)21(31)24-16-7-9-17(10-8-16)29-19(30)12-15-5-3-4-6-18(15)26-29/h11-12,16-17H,3-10H2,1-2H3,(H,24,31) |
| InChIKey | HDFJKFPNACTLGW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 107.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.51 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |