C20H26N4O2S — CID 126936122
2-[4-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylamino)cyclohexyl]-7,8-dihydro-5H-pyrano[4,3-c]pyridazin-3-one (PubChem CID 126936122) has the molecular formula C20H26N4O2S and a molecular weight of 386.52 g/mol. Its IUPAC name is 2-[4-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylamino)cyclohexyl]-7,8-dihydro-5H-pyrano[4,3-c]pyridazin-3-one.
| Compound Name | 2-[4-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylamino)cyclohexyl]-7,8-dihydro-5H-pyrano[4,3-c]pyridazin-3-one |
|---|---|
| PubChem CID | 126936122 |
| Molecular Formula | C20H26N4O2S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 2-[4-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylamino)cyclohexyl]-7,8-dihydro-5H-pyrano[4,3-c]pyridazin-3-one |
| SMILES | O=c1cc2c(nn1C1CCC(Nc3nc4c(s3)CCCC4)CC1)CCOC2 |
| InChI | InChI=1S/C20H26N4O2S/c25-19-11-13-12-26-10-9-16(13)23-24(19)15-7-5-14(6-8-15)21-20-22-17-3-1-2-4-18(17)27-20/h11,14-15H,1-10,12H2,(H,21,22) |
| InChIKey | DVYXOSNUBKAHMQ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |