C20H34N4O — CID 126937906
6-tert-butyl-2-[2-[2-[(cyclobutylamino)methyl]piperidin-1-yl]ethyl]pyridazin-3-one (PubChem CID 126937906) has the molecular formula C20H34N4O and a molecular weight of 346.52 g/mol. Its IUPAC name is 6-tert-butyl-2-[2-[2-[(cyclobutylamino)methyl]piperidin-1-yl]ethyl]pyridazin-3-one.
| Compound Name | 6-tert-butyl-2-[2-[2-[(cyclobutylamino)methyl]piperidin-1-yl]ethyl]pyridazin-3-one |
|---|---|
| PubChem CID | 126937906 |
| Molecular Formula | C20H34N4O |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.27 |
| IUPAC Name | 6-tert-butyl-2-[2-[2-[(cyclobutylamino)methyl]piperidin-1-yl]ethyl]pyridazin-3-one |
| SMILES | CC(C)(C)c1ccc(=O)n(CCN2CCCCC2CNC2CCC2)n1 |
| InChI | InChI=1S/C20H34N4O/c1-20(2,3)18-10-11-19(25)24(22-18)14-13-23-12-5-4-9-17(23)15-21-16-7-6-8-16/h10-11,16-17,21H,4-9,12-15H2,1-3H3 |
| InChIKey | YHSZXSKBZSSICH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |