C21H28N8OS — CID 126938544
2-[2-[2-[[(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)amino]methyl]piperidin-1-yl]ethyl]-7,8-dihydro-5H-thiopyrano[4,3-c]pyridazin-3-one (PubChem CID 126938544) has the molecular formula C21H28N8OS and a molecular weight of 440.58 g/mol. Its IUPAC name is 2-[2-[2-[[(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)amino]methyl]piperidin-1-yl]ethyl]-7,8-dihydro-5H-thiopyrano[4,3-c]pyridazin-3-one.
| Compound Name | 2-[2-[2-[[(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)amino]methyl]piperidin-1-yl]ethyl]-7,8-dihydro-5H-thiopyrano[4,3-c]pyridazin-3-one |
|---|---|
| PubChem CID | 126938544 |
| Molecular Formula | C21H28N8OS |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 2-[2-[2-[[(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)amino]methyl]piperidin-1-yl]ethyl]-7,8-dihydro-5H-thiopyrano[4,3-c]pyridazin-3-one |
| SMILES | Cc1nnc2ccc(NCC3CCCCN3CCn3nc4c(cc3=O)CSCC4)nn12 |
| InChI | InChI=1S/C21H28N8OS/c1-15-23-24-20-6-5-19(26-29(15)20)22-13-17-4-2-3-8-27(17)9-10-28-21(30)12-16-14-31-11-7-18(16)25-28/h5-6,12,17H,2-4,7-11,13-14H2,1H3,(H,22,26) |
| InChIKey | BAQIWBMTZXCNSF-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 93.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |