C14H15ClN4O2 — CID 126938814
2-[4-[(3-chloro-4-pyridinyl)amino]oxolan-3-yl]-6-methylpyridazin-3-one (PubChem CID 126938814) has the molecular formula C14H15ClN4O2 and a molecular weight of 306.75 g/mol. Its IUPAC name is 2-[4-[(3-chloro-4-pyridinyl)amino]oxolan-3-yl]-6-methylpyridazin-3-one.
| Compound Name | 2-[4-[(3-chloro-4-pyridinyl)amino]oxolan-3-yl]-6-methylpyridazin-3-one |
|---|---|
| PubChem CID | 126938814 |
| Molecular Formula | C14H15ClN4O2 |
| Molecular Weight | 306.75 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 2-[4-[(3-chloro-4-pyridinyl)amino]oxolan-3-yl]-6-methylpyridazin-3-one |
| SMILES | Cc1ccc(=O)n(C2COCC2Nc2ccncc2Cl)n1 |
| InChI | InChI=1S/C14H15ClN4O2/c1-9-2-3-14(20)19(18-9)13-8-21-7-12(13)17-11-4-5-16-6-10(11)15/h2-6,12-13H,7-8H2,1H3,(H,16,17) |
| InChIKey | BGIQQGFHQBHRPT-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.75 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |