C20H21N5O2 — CID 126939567
2-[4-(phthalazin-1-ylamino)oxolan-3-yl]-5,6,7,8-tetrahydrocinnolin-3-one (PubChem CID 126939567) has the molecular formula C20H21N5O2 and a molecular weight of 363.42 g/mol. Its IUPAC name is 2-[4-(phthalazin-1-ylamino)oxolan-3-yl]-5,6,7,8-tetrahydrocinnolin-3-one.
| Compound Name | 2-[4-(phthalazin-1-ylamino)oxolan-3-yl]-5,6,7,8-tetrahydrocinnolin-3-one |
|---|---|
| PubChem CID | 126939567 |
| Molecular Formula | C20H21N5O2 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 2-[4-(phthalazin-1-ylamino)oxolan-3-yl]-5,6,7,8-tetrahydrocinnolin-3-one |
| SMILES | O=c1cc2c(nn1C1COCC1Nc1nncc3ccccc13)CCCC2 |
| InChI | InChI=1S/C20H21N5O2/c26-19-9-13-5-2-4-8-16(13)24-25(19)18-12-27-11-17(18)22-20-15-7-3-1-6-14(15)10-21-23-20/h1,3,6-7,9-10,17-18H,2,4-5,8,11-12H2,(H,22,23) |
| InChIKey | BDJDMBDXRAMPDW-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |