C20H21N5O4 — CID 126940009
6-(3-methoxyphenyl)-2-[4-[(1-methyl-6-oxopyrimidin-4-yl)amino]oxolan-3-yl]pyridazin-3-one (PubChem CID 126940009) has the molecular formula C20H21N5O4 and a molecular weight of 395.42 g/mol. Its IUPAC name is 6-(3-methoxyphenyl)-2-[4-[(1-methyl-6-oxopyrimidin-4-yl)amino]oxolan-3-yl]pyridazin-3-one.
| Compound Name | 6-(3-methoxyphenyl)-2-[4-[(1-methyl-6-oxopyrimidin-4-yl)amino]oxolan-3-yl]pyridazin-3-one |
|---|---|
| PubChem CID | 126940009 |
| Molecular Formula | C20H21N5O4 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 6-(3-methoxyphenyl)-2-[4-[(1-methyl-6-oxopyrimidin-4-yl)amino]oxolan-3-yl]pyridazin-3-one |
| SMILES | COc1cccc(-c2ccc(=O)n(C3COCC3Nc3cc(=O)n(C)cn3)n2)c1 |
| InChI | InChI=1S/C20H21N5O4/c1-24-12-21-18(9-20(24)27)22-16-10-29-11-17(16)25-19(26)7-6-15(23-25)13-4-3-5-14(8-13)28-2/h3-9,12,16-17,22H,10-11H2,1-2H3 |
| InChIKey | JMAIPYLQMBXONU-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |