About 1-(2,4-dichlorophenyl)-1'-methylspiro[1H-2-benzothiophene-3,4'-piperidine];hydrobromide
1-(2,4-dichlorophenyl)-1'-methylspiro[1H-2-benzothiophene-3,4'-piperidine];hydrobromide (PubChem CID 12694079) has the molecular formula C19H20BrCl2NS
and a molecular weight of 445.25 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-1'-methylspiro[1H-2-benzothiophene-3,4'-piperidine];hydrobromide.
Molecular Properties
| Compound Name | 1-(2,4-dichlorophenyl)-1'-methylspiro[1H-2-benzothiophene-3,4'-piperidine];hydrobromide |
| PubChem CID | 12694079 |
| Molecular Formula | C19H20BrCl2NS |
| Molecular Weight | 445.25 g/mol |
| Exact Mass | 442.99 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-1'-methylspiro[1H-2-benzothiophene-3,4'-piperidine];hydrobromide |
| SMILES | Br.CN1CCC2(CC1)SC(c1ccc(Cl)cc1Cl)c1ccccc12 |
| InChI | InChI=1S/C19H19Cl2NS.BrH/c1-22-10-8-19(9-11-22)16-5-3-2-4-14(16)18(23-19)15-7-6-13(20)12-17(15)21;/h2-7,12,18H,8-11H2,1H3;1H |
| InChIKey | XFZZJTZVKSYMEA-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 445.25 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2,4-dichlorophenyl)-1'-methylspiro[1H-2-benzothiophene-3,4'-piperidine];hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,4-dichlorophenyl)-1'-methylspiro[1H-2-benzothiophene-3,4'-piperidine];hydrobromide?
The IUPAC name of 1-(2,4-dichlorophenyl)-1'-methylspiro[1H-2-benzothiophene-3,4'-piperidine];hydrobromide (CID 12694079) is 1-(2,4-dichlorophenyl)-1'-methylspiro[1H-2-benzothiophene-3,4'-piperidine];hydrobromide.
What is the SMILES notation for 1-(2,4-dichlorophenyl)-1'-methylspiro[1H-2-benzothiophene-3,4'-piperidine];hydrobromide?
The canonical SMILES for 1-(2,4-dichlorophenyl)-1'-methylspiro[1H-2-benzothiophene-3,4'-piperidine];hydrobromide is Br.CN1CCC2(CC1)SC(c1ccc(Cl)cc1Cl)c1ccccc12.
What is the InChIKey of 1-(2,4-dichlorophenyl)-1'-methylspiro[1H-2-benzothiophene-3,4'-piperidine];hydrobromide?
The InChIKey is XFZZJTZVKSYMEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19Cl2NS.BrH/c1-22-10-8-19(9-11-22)16-5-3-2-4-14(16)18(23-19)15-7-6-13(20)12-17(15)21;/h2-7,12,18H,8-11H2,1H3;1H.
What are the key properties of 1-(2,4-dichlorophenyl)-1'-methylspiro[1H-2-benzothiophene-3,4'-piperidine];hydrobromide?
1-(2,4-dichlorophenyl)-1'-methylspiro[1H-2-benzothiophene-3,4'-piperidine];hydrobromide has a molecular weight of 445.25 g/mol, XLogP of 6.33, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,4-dichlorophenyl)-1'-methylspiro[1H-2-benzothiophene-3,4'-piperidine];hydrobromide is sourced from PubChem (CID 12694079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).