C21H25N5O — CID 126942191
3-[(1-phthalazin-1-ylpiperidin-4-yl)methyl]-6-propan-2-ylpyrimidin-4-one (PubChem CID 126942191) has the molecular formula C21H25N5O and a molecular weight of 363.47 g/mol. Its IUPAC name is 3-[(1-phthalazin-1-ylpiperidin-4-yl)methyl]-6-propan-2-ylpyrimidin-4-one.
| Compound Name | 3-[(1-phthalazin-1-ylpiperidin-4-yl)methyl]-6-propan-2-ylpyrimidin-4-one |
|---|---|
| PubChem CID | 126942191 |
| Molecular Formula | C21H25N5O |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | 3-[(1-phthalazin-1-ylpiperidin-4-yl)methyl]-6-propan-2-ylpyrimidin-4-one |
| SMILES | CC(C)c1cc(=O)n(CC2CCN(c3nncc4ccccc34)CC2)cn1 |
| InChI | InChI=1S/C21H25N5O/c1-15(2)19-11-20(27)26(14-22-19)13-16-7-9-25(10-8-16)21-18-6-4-3-5-17(18)12-23-24-21/h3-6,11-12,14-16H,7-10,13H2,1-2H3 |
| InChIKey | RVYUWMZCISZSHX-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |