C20H26N4O — CID 126943238
3-[[1-(cyclobutylmethyl)piperidin-4-yl]methyl]-6-pyridin-3-ylpyrimidin-4-one (PubChem CID 126943238) has the molecular formula C20H26N4O and a molecular weight of 338.45 g/mol. Its IUPAC name is 3-[[1-(cyclobutylmethyl)piperidin-4-yl]methyl]-6-pyridin-3-ylpyrimidin-4-one.
| Compound Name | 3-[[1-(cyclobutylmethyl)piperidin-4-yl]methyl]-6-pyridin-3-ylpyrimidin-4-one |
|---|---|
| PubChem CID | 126943238 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 3-[[1-(cyclobutylmethyl)piperidin-4-yl]methyl]-6-pyridin-3-ylpyrimidin-4-one |
| SMILES | O=c1cc(-c2cccnc2)ncn1CC1CCN(CC2CCC2)CC1 |
| InChI | InChI=1S/C20H26N4O/c25-20-11-19(18-5-2-8-21-12-18)22-15-24(20)14-17-6-9-23(10-7-17)13-16-3-1-4-16/h2,5,8,11-12,15-17H,1,3-4,6-7,9-10,13-14H2 |
| InChIKey | XZYVMUAGOHNGCO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |