C16H23F2N3O — CID 126944098
3-[[1-(cyclobutylmethyl)piperidin-4-yl]methyl]-6-(difluoromethyl)pyrimidin-4-one (PubChem CID 126944098) has the molecular formula C16H23F2N3O and a molecular weight of 311.38 g/mol. Its IUPAC name is 3-[[1-(cyclobutylmethyl)piperidin-4-yl]methyl]-6-(difluoromethyl)pyrimidin-4-one.
| Compound Name | 3-[[1-(cyclobutylmethyl)piperidin-4-yl]methyl]-6-(difluoromethyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 126944098 |
| Molecular Formula | C16H23F2N3O |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | 3-[[1-(cyclobutylmethyl)piperidin-4-yl]methyl]-6-(difluoromethyl)pyrimidin-4-one |
| SMILES | O=c1cc(C(F)F)ncn1CC1CCN(CC2CCC2)CC1 |
| InChI | InChI=1S/C16H23F2N3O/c17-16(18)14-8-15(22)21(11-19-14)10-13-4-6-20(7-5-13)9-12-2-1-3-12/h8,11-13,16H,1-7,9-10H2 |
| InChIKey | CHEHGCCJUZJHJZ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |