C22H29N5O — CID 126944389
6-tert-butyl-3-[[1-(1-methylbenzimidazol-2-yl)piperidin-4-yl]methyl]pyrimidin-4-one (PubChem CID 126944389) has the molecular formula C22H29N5O and a molecular weight of 379.51 g/mol. Its IUPAC name is 6-tert-butyl-3-[[1-(1-methylbenzimidazol-2-yl)piperidin-4-yl]methyl]pyrimidin-4-one.
| Compound Name | 6-tert-butyl-3-[[1-(1-methylbenzimidazol-2-yl)piperidin-4-yl]methyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 126944389 |
| Molecular Formula | C22H29N5O |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | 6-tert-butyl-3-[[1-(1-methylbenzimidazol-2-yl)piperidin-4-yl]methyl]pyrimidin-4-one |
| SMILES | Cn1c(N2CCC(Cn3cnc(C(C)(C)C)cc3=O)CC2)nc2ccccc21 |
| InChI | InChI=1S/C22H29N5O/c1-22(2,3)19-13-20(28)27(15-23-19)14-16-9-11-26(12-10-16)21-24-17-7-5-6-8-18(17)25(21)4/h5-8,13,15-16H,9-12,14H2,1-4H3 |
| InChIKey | HMVRJZIBUXBJQT-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 55.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |