C18H28N6O — CID 126944504
6-tert-butyl-3-[[1-[(1-methyltriazol-4-yl)methyl]piperidin-4-yl]methyl]pyrimidin-4-one (PubChem CID 126944504) has the molecular formula C18H28N6O and a molecular weight of 344.46 g/mol. Its IUPAC name is 6-tert-butyl-3-[[1-[(1-methyltriazol-4-yl)methyl]piperidin-4-yl]methyl]pyrimidin-4-one.
| Compound Name | 6-tert-butyl-3-[[1-[(1-methyltriazol-4-yl)methyl]piperidin-4-yl]methyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 126944504 |
| Molecular Formula | C18H28N6O |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.23 |
| IUPAC Name | 6-tert-butyl-3-[[1-[(1-methyltriazol-4-yl)methyl]piperidin-4-yl]methyl]pyrimidin-4-one |
| SMILES | Cn1cc(CN2CCC(Cn3cnc(C(C)(C)C)cc3=O)CC2)nn1 |
| InChI | InChI=1S/C18H28N6O/c1-18(2,3)16-9-17(25)24(13-19-16)10-14-5-7-23(8-6-14)12-15-11-22(4)21-20-15/h9,11,13-14H,5-8,10,12H2,1-4H3 |
| InChIKey | VVKMTUGLZWBASY-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 68.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |