C21H17NO2 — CID 12694467
(3S,4R)-4-hydroxy-2,3-diphenyl-3,4-dihydroisoquinolin-1-one (PubChem CID 12694467) has the molecular formula C21H17NO2 and a molecular weight of 315.37 g/mol. Its IUPAC name is (3S,4R)-4-hydroxy-2,3-diphenyl-3,4-dihydroisoquinolin-1-one.
| Compound Name | (3S,4R)-4-hydroxy-2,3-diphenyl-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 12694467 |
| Molecular Formula | C21H17NO2 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | (3S,4R)-4-hydroxy-2,3-diphenyl-3,4-dihydroisoquinolin-1-one |
| SMILES | O=C1c2ccccc2[C@@H](O)[C@H](c2ccccc2)N1c1ccccc1 |
| InChI | InChI=1S/C21H17NO2/c23-20-17-13-7-8-14-18(17)21(24)22(16-11-5-2-6-12-16)19(20)15-9-3-1-4-10-15/h1-14,19-20,23H/t19-,20+/m0/s1 |
| InChIKey | TYQCMZFNZOTIKY-VQTJNVASSA-N |
| XLogP | 4.12 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |