C11H16N4O — CID 126945570
1-[1-(1-methylazetidin-3-yl)pyrazol-4-yl]pyrrolidin-2-one (PubChem CID 126945570) has the molecular formula C11H16N4O and a molecular weight of 220.28 g/mol. Its IUPAC name is 1-[1-(1-methylazetidin-3-yl)pyrazol-4-yl]pyrrolidin-2-one.
| Compound Name | 1-[1-(1-methylazetidin-3-yl)pyrazol-4-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 126945570 |
| Molecular Formula | C11H16N4O |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 1-[1-(1-methylazetidin-3-yl)pyrazol-4-yl]pyrrolidin-2-one |
| SMILES | CN1CC(n2cc(N3CCCC3=O)cn2)C1 |
| InChI | InChI=1S/C11H16N4O/c1-13-6-10(7-13)15-8-9(5-12-15)14-4-2-3-11(14)16/h5,8,10H,2-4,6-7H2,1H3 |
| InChIKey | KFVXDYXTGJDMIN-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |