C10H8N2OS2 — CID 1269456
(5Z)-3-amino-5-benzylidene-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 1269456) has the molecular formula C10H8N2OS2 and a molecular weight of 236.32 g/mol. Its IUPAC name is (5Z)-3-amino-5-benzylidene-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-amino-5-benzylidene-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 1269456 |
| Molecular Formula | C10H8N2OS2 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.01 |
| IUPAC Name | (5Z)-3-amino-5-benzylidene-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | NN1C(=O)/C(=C/c2ccccc2)SC1=S |
| InChI | InChI=1S/C10H8N2OS2/c11-12-9(13)8(15-10(12)14)6-7-4-2-1-3-5-7/h1-6H,11H2/b8-6- |
| InChIKey | RADJDINPADSTBJ-VURMDHGXSA-N |
| XLogP | 1.76 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|