C5H7N5O3 — CID 1269462
2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]acetamide (PubChem CID 1269462) has the molecular formula C5H7N5O3 and a molecular weight of 185.14 g/mol. Its IUPAC name is 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]acetamide.
| Compound Name | 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]acetamide |
|---|---|
| PubChem CID | 1269462 |
| Molecular Formula | C5H7N5O3 |
| Molecular Weight | 185.14 g/mol |
| Exact Mass | 185.05 |
| IUPAC Name | 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]acetamide |
| SMILES | NC(=O)CNc1n[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C5H7N5O3/c6-2(11)1-7-3-4(12)8-5(13)10-9-3/h1H2,(H2,6,11)(H,7,9)(H2,8,10,12,13) |
| InChIKey | LXWRRWGYQJALEN-UHFFFAOYSA-N |
| XLogP | -2.64 |
| TPSA | 133.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.14 |
| LogP ≤ 5 | -2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |