About 8-(2,4,6-trimethylpyridin-1-ium-1-yl)naphthalen-1-amine perchlorate
8-(2,4,6-trimethylpyridin-1-ium-1-yl)naphthalen-1-amine perchlorate (PubChem CID 12694656) has the molecular formula C18H19ClN2O4
and a molecular weight of 362.81 g/mol. Its IUPAC name is 8-(2,4,6-trimethylpyridin-1-ium-1-yl)naphthalen-1-amine perchlorate.
Molecular Properties
| Compound Name | 8-(2,4,6-trimethylpyridin-1-ium-1-yl)naphthalen-1-amine perchlorate |
| PubChem CID | 12694656 |
| Molecular Formula | C18H19ClN2O4 |
| Molecular Weight | 362.81 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 8-(2,4,6-trimethylpyridin-1-ium-1-yl)naphthalen-1-amine perchlorate |
| SMILES | Cc1cc(C)[n+](-c2cccc3cccc(N)c23)c(C)c1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C18H19N2.ClHO4/c1-12-10-13(2)20(14(3)11-12)17-9-5-7-15-6-4-8-16(19)18(15)17;2-1(3,4)5/h4-11H,19H2,1-3H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | ABQOCZZLRMLODM-UHFFFAOYSA-M |
| XLogP | -1.13 |
| TPSA | 122.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.81 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 8-(2,4,6-trimethylpyridin-1-ium-1-yl)naphthalen-1-amine perchlorate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(2,4,6-trimethylpyridin-1-ium-1-yl)naphthalen-1-amine perchlorate?
The IUPAC name of 8-(2,4,6-trimethylpyridin-1-ium-1-yl)naphthalen-1-amine perchlorate (CID 12694656) is 8-(2,4,6-trimethylpyridin-1-ium-1-yl)naphthalen-1-amine perchlorate.
What is the SMILES notation for 8-(2,4,6-trimethylpyridin-1-ium-1-yl)naphthalen-1-amine perchlorate?
The canonical SMILES for 8-(2,4,6-trimethylpyridin-1-ium-1-yl)naphthalen-1-amine perchlorate is Cc1cc(C)[n+](-c2cccc3cccc(N)c23)c(C)c1.[O-][Cl+3]([O-])([O-])[O-].
What is the InChIKey of 8-(2,4,6-trimethylpyridin-1-ium-1-yl)naphthalen-1-amine perchlorate?
The InChIKey is ABQOCZZLRMLODM-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H19N2.ClHO4/c1-12-10-13(2)20(14(3)11-12)17-9-5-7-15-6-4-8-16(19)18(15)17;2-1(3,4)5/h4-11H,19H2,1-3H3;(H,2,3,4,5)/q+1;/p-1.
What are the key properties of 8-(2,4,6-trimethylpyridin-1-ium-1-yl)naphthalen-1-amine perchlorate?
8-(2,4,6-trimethylpyridin-1-ium-1-yl)naphthalen-1-amine perchlorate has a molecular weight of 362.81 g/mol, XLogP of -1.13, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(2,4,6-trimethylpyridin-1-ium-1-yl)naphthalen-1-amine perchlorate is sourced from PubChem (CID 12694656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).