About 2-methoxy-1,3-benzothiazol-6-amine
2-methoxy-1,3-benzothiazol-6-amine (PubChem CID 12694716) has the molecular formula C8H8N2OS
and a molecular weight of 180.23 g/mol. Its IUPAC name is 2-methoxy-1,3-benzothiazol-6-amine.
Molecular Properties
| Compound Name | 2-methoxy-1,3-benzothiazol-6-amine |
| PubChem CID | 12694716 |
| Molecular Formula | C8H8N2OS |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | 2-methoxy-1,3-benzothiazol-6-amine |
| SMILES | COc1nc2ccc(N)cc2s1 |
| InChI | InChI=1S/C8H8N2OS/c1-11-8-10-6-3-2-5(9)4-7(6)12-8/h2-4H,9H2,1H3 |
| InChIKey | LMDPSNUTSFKGTO-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxy-1,3-benzothiazol-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-1,3-benzothiazol-6-amine?
The IUPAC name of 2-methoxy-1,3-benzothiazol-6-amine (CID 12694716) is 2-methoxy-1,3-benzothiazol-6-amine.
What is the SMILES notation for 2-methoxy-1,3-benzothiazol-6-amine?
The canonical SMILES for 2-methoxy-1,3-benzothiazol-6-amine is COc1nc2ccc(N)cc2s1.
What is the InChIKey of 2-methoxy-1,3-benzothiazol-6-amine?
The InChIKey is LMDPSNUTSFKGTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2OS/c1-11-8-10-6-3-2-5(9)4-7(6)12-8/h2-4H,9H2,1H3.
What are the key properties of 2-methoxy-1,3-benzothiazol-6-amine?
2-methoxy-1,3-benzothiazol-6-amine has a molecular weight of 180.23 g/mol, XLogP of 1.89, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-1,3-benzothiazol-6-amine is sourced from PubChem (CID 12694716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).