C18H17F2N5O — CID 126950143
3-(2,2-difluoroethyl)-2-(1-pyrazin-2-ylpyrrolidin-2-yl)quinazolin-4-one (PubChem CID 126950143) has the molecular formula C18H17F2N5O and a molecular weight of 357.36 g/mol. Its IUPAC name is 3-(2,2-difluoroethyl)-2-(1-pyrazin-2-ylpyrrolidin-2-yl)quinazolin-4-one.
| Compound Name | 3-(2,2-difluoroethyl)-2-(1-pyrazin-2-ylpyrrolidin-2-yl)quinazolin-4-one |
|---|---|
| PubChem CID | 126950143 |
| Molecular Formula | C18H17F2N5O |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 3-(2,2-difluoroethyl)-2-(1-pyrazin-2-ylpyrrolidin-2-yl)quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(C2CCCN2c2cnccn2)n1CC(F)F |
| InChI | InChI=1S/C18H17F2N5O/c19-15(20)11-25-17(23-13-5-2-1-4-12(13)18(25)26)14-6-3-9-24(14)16-10-21-7-8-22-16/h1-2,4-5,7-8,10,14-15H,3,6,9,11H2 |
| InChIKey | FMCGJWBSHBCCOB-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |