C20H23N5O3 — CID 126951387
3-(2-methoxyethyl)-2-[1-(1-methyl-6-oxopyrimidin-4-yl)pyrrolidin-2-yl]quinazolin-4-one (PubChem CID 126951387) has the molecular formula C20H23N5O3 and a molecular weight of 381.44 g/mol. Its IUPAC name is 3-(2-methoxyethyl)-2-[1-(1-methyl-6-oxopyrimidin-4-yl)pyrrolidin-2-yl]quinazolin-4-one.
| Compound Name | 3-(2-methoxyethyl)-2-[1-(1-methyl-6-oxopyrimidin-4-yl)pyrrolidin-2-yl]quinazolin-4-one |
|---|---|
| PubChem CID | 126951387 |
| Molecular Formula | C20H23N5O3 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 3-(2-methoxyethyl)-2-[1-(1-methyl-6-oxopyrimidin-4-yl)pyrrolidin-2-yl]quinazolin-4-one |
| SMILES | COCCn1c(C2CCCN2c2cc(=O)n(C)cn2)nc2ccccc2c1=O |
| InChI | InChI=1S/C20H23N5O3/c1-23-13-21-17(12-18(23)26)24-9-5-8-16(24)19-22-15-7-4-3-6-14(15)20(27)25(19)10-11-28-2/h3-4,6-7,12-13,16H,5,8-11H2,1-2H3 |
| InChIKey | POBRIHFGUPRLBH-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 82.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |