C9H10N4O — CID 126953697
2,4-dimethyl-5-pyridin-3-yl-1,2,4-triazol-3-one (PubChem CID 126953697) has the molecular formula C9H10N4O and a molecular weight of 190.21 g/mol. Its IUPAC name is 2,4-dimethyl-5-pyridin-3-yl-1,2,4-triazol-3-one.
| Compound Name | 2,4-dimethyl-5-pyridin-3-yl-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 126953697 |
| Molecular Formula | C9H10N4O |
| Molecular Weight | 190.21 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | 2,4-dimethyl-5-pyridin-3-yl-1,2,4-triazol-3-one |
| SMILES | Cn1nc(-c2cccnc2)n(C)c1=O |
| InChI | InChI=1S/C9H10N4O/c1-12-8(11-13(2)9(12)14)7-4-3-5-10-6-7/h3-6H,1-2H3 |
| InChIKey | WPKHCTHKJNFYDL-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.21 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |