C9H15N3O — CID 126953783
3-cyclohexyl-4-methyl-1H-1,2,4-triazol-5-one (PubChem CID 126953783) has the molecular formula C9H15N3O and a molecular weight of 181.24 g/mol. Its IUPAC name is 3-cyclohexyl-4-methyl-1H-1,2,4-triazol-5-one.
| Compound Name | 3-cyclohexyl-4-methyl-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 126953783 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | 3-cyclohexyl-4-methyl-1H-1,2,4-triazol-5-one |
| SMILES | Cn1c(C2CCCCC2)n[nH]c1=O |
| InChI | InChI=1S/C9H15N3O/c1-12-8(10-11-9(12)13)7-5-3-2-4-6-7/h7H,2-6H2,1H3,(H,11,13) |
| InChIKey | VDDFLGWLYBPSHT-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |