About 5-cyclohexyl-2,4-dimethyl-1,2,4-triazol-3-one
5-cyclohexyl-2,4-dimethyl-1,2,4-triazol-3-one (PubChem CID 126953785) has the molecular formula C10H17N3O
and a molecular weight of 195.27 g/mol. Its IUPAC name is 5-cyclohexyl-2,4-dimethyl-1,2,4-triazol-3-one.
Molecular Properties
| Compound Name | 5-cyclohexyl-2,4-dimethyl-1,2,4-triazol-3-one |
| PubChem CID | 126953785 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | 5-cyclohexyl-2,4-dimethyl-1,2,4-triazol-3-one |
| SMILES | Cn1nc(C2CCCCC2)n(C)c1=O |
| InChI | InChI=1S/C10H17N3O/c1-12-9(11-13(2)10(12)14)8-6-4-3-5-7-8/h8H,3-7H2,1-2H3 |
| InChIKey | XUTUIKPOQLOIHH-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-cyclohexyl-2,4-dimethyl-1,2,4-triazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclohexyl-2,4-dimethyl-1,2,4-triazol-3-one?
The IUPAC name of 5-cyclohexyl-2,4-dimethyl-1,2,4-triazol-3-one (CID 126953785) is 5-cyclohexyl-2,4-dimethyl-1,2,4-triazol-3-one.
What is the SMILES notation for 5-cyclohexyl-2,4-dimethyl-1,2,4-triazol-3-one?
The canonical SMILES for 5-cyclohexyl-2,4-dimethyl-1,2,4-triazol-3-one is Cn1nc(C2CCCCC2)n(C)c1=O.
What is the InChIKey of 5-cyclohexyl-2,4-dimethyl-1,2,4-triazol-3-one?
The InChIKey is XUTUIKPOQLOIHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O/c1-12-9(11-13(2)10(12)14)8-6-4-3-5-7-8/h8H,3-7H2,1-2H3.
What are the key properties of 5-cyclohexyl-2,4-dimethyl-1,2,4-triazol-3-one?
5-cyclohexyl-2,4-dimethyl-1,2,4-triazol-3-one has a molecular weight of 195.27 g/mol, XLogP of 1.17, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclohexyl-2,4-dimethyl-1,2,4-triazol-3-one is sourced from PubChem (CID 126953785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).