About 2-[(3,3-difluorocyclobutyl)methoxy]-1,3-thiazole
2-[(3,3-difluorocyclobutyl)methoxy]-1,3-thiazole (PubChem CID 126954013) has the molecular formula C8H9F2NOS
and a molecular weight of 205.23 g/mol. Its IUPAC name is 2-[(3,3-difluorocyclobutyl)methoxy]-1,3-thiazole.
Molecular Properties
| Compound Name | 2-[(3,3-difluorocyclobutyl)methoxy]-1,3-thiazole |
| PubChem CID | 126954013 |
| Molecular Formula | C8H9F2NOS |
| Molecular Weight | 205.23 g/mol |
| Exact Mass | 205.04 |
| IUPAC Name | 2-[(3,3-difluorocyclobutyl)methoxy]-1,3-thiazole |
| SMILES | FC1(F)CC(COc2nccs2)C1 |
| InChI | InChI=1S/C8H9F2NOS/c9-8(10)3-6(4-8)5-12-7-11-1-2-13-7/h1-2,6H,3-5H2 |
| InChIKey | KFIBUJCIPGZWLU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.23 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(3,3-difluorocyclobutyl)methoxy]-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3,3-difluorocyclobutyl)methoxy]-1,3-thiazole?
The IUPAC name of 2-[(3,3-difluorocyclobutyl)methoxy]-1,3-thiazole (CID 126954013) is 2-[(3,3-difluorocyclobutyl)methoxy]-1,3-thiazole.
What is the SMILES notation for 2-[(3,3-difluorocyclobutyl)methoxy]-1,3-thiazole?
The canonical SMILES for 2-[(3,3-difluorocyclobutyl)methoxy]-1,3-thiazole is FC1(F)CC(COc2nccs2)C1.
What is the InChIKey of 2-[(3,3-difluorocyclobutyl)methoxy]-1,3-thiazole?
The InChIKey is KFIBUJCIPGZWLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F2NOS/c9-8(10)3-6(4-8)5-12-7-11-1-2-13-7/h1-2,6H,3-5H2.
What are the key properties of 2-[(3,3-difluorocyclobutyl)methoxy]-1,3-thiazole?
2-[(3,3-difluorocyclobutyl)methoxy]-1,3-thiazole has a molecular weight of 205.23 g/mol, XLogP of 2.57, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,3-difluorocyclobutyl)methoxy]-1,3-thiazole is sourced from PubChem (CID 126954013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).