About 4-[(3,3-difluorocyclobutyl)methoxy]-5,6-dimethylpyrimidine
4-[(3,3-difluorocyclobutyl)methoxy]-5,6-dimethylpyrimidine (PubChem CID 126954435) has the molecular formula C11H14F2N2O
and a molecular weight of 228.24 g/mol. Its IUPAC name is 4-[(3,3-difluorocyclobutyl)methoxy]-5,6-dimethylpyrimidine.
Molecular Properties
| Compound Name | 4-[(3,3-difluorocyclobutyl)methoxy]-5,6-dimethylpyrimidine |
| PubChem CID | 126954435 |
| Molecular Formula | C11H14F2N2O |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 4-[(3,3-difluorocyclobutyl)methoxy]-5,6-dimethylpyrimidine |
| SMILES | Cc1ncnc(OCC2CC(F)(F)C2)c1C |
| InChI | InChI=1S/C11H14F2N2O/c1-7-8(2)14-6-15-10(7)16-5-9-3-11(12,13)4-9/h6,9H,3-5H2,1-2H3 |
| InChIKey | MINRMMHNOMAMFB-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(3,3-difluorocyclobutyl)methoxy]-5,6-dimethylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3,3-difluorocyclobutyl)methoxy]-5,6-dimethylpyrimidine?
The IUPAC name of 4-[(3,3-difluorocyclobutyl)methoxy]-5,6-dimethylpyrimidine (CID 126954435) is 4-[(3,3-difluorocyclobutyl)methoxy]-5,6-dimethylpyrimidine.
What is the SMILES notation for 4-[(3,3-difluorocyclobutyl)methoxy]-5,6-dimethylpyrimidine?
The canonical SMILES for 4-[(3,3-difluorocyclobutyl)methoxy]-5,6-dimethylpyrimidine is Cc1ncnc(OCC2CC(F)(F)C2)c1C.
What is the InChIKey of 4-[(3,3-difluorocyclobutyl)methoxy]-5,6-dimethylpyrimidine?
The InChIKey is MINRMMHNOMAMFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14F2N2O/c1-7-8(2)14-6-15-10(7)16-5-9-3-11(12,13)4-9/h6,9H,3-5H2,1-2H3.
What are the key properties of 4-[(3,3-difluorocyclobutyl)methoxy]-5,6-dimethylpyrimidine?
4-[(3,3-difluorocyclobutyl)methoxy]-5,6-dimethylpyrimidine has a molecular weight of 228.24 g/mol, XLogP of 2.52, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3,3-difluorocyclobutyl)methoxy]-5,6-dimethylpyrimidine is sourced from PubChem (CID 126954435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).