C10H11F3N2O — CID 126954441
4-cyclopropyl-6-(1,1,1-trifluoropropan-2-yloxy)pyrimidine (PubChem CID 126954441) has the molecular formula C10H11F3N2O and a molecular weight of 232.20 g/mol. Its IUPAC name is 4-cyclopropyl-6-(1,1,1-trifluoropropan-2-yloxy)pyrimidine.
| Compound Name | 4-cyclopropyl-6-(1,1,1-trifluoropropan-2-yloxy)pyrimidine |
|---|---|
| PubChem CID | 126954441 |
| Molecular Formula | C10H11F3N2O |
| Molecular Weight | 232.20 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 4-cyclopropyl-6-(1,1,1-trifluoropropan-2-yloxy)pyrimidine |
| SMILES | CC(Oc1cc(C2CC2)ncn1)C(F)(F)F |
| InChI | InChI=1S/C10H11F3N2O/c1-6(10(11,12)13)16-9-4-8(7-2-3-7)14-5-15-9/h4-7H,2-3H2,1H3 |
| InChIKey | AMOVNSPOBKRURZ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.20 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |