C10H12F2N2O — CID 126954579
4-(2,2-difluoroethoxy)-5,6,7,8-tetrahydroquinazoline (PubChem CID 126954579) has the molecular formula C10H12F2N2O and a molecular weight of 214.22 g/mol. Its IUPAC name is 4-(2,2-difluoroethoxy)-5,6,7,8-tetrahydroquinazoline.
| Compound Name | 4-(2,2-difluoroethoxy)-5,6,7,8-tetrahydroquinazoline |
|---|---|
| PubChem CID | 126954579 |
| Molecular Formula | C10H12F2N2O |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 4-(2,2-difluoroethoxy)-5,6,7,8-tetrahydroquinazoline |
| SMILES | FC(F)COc1ncnc2c1CCCC2 |
| InChI | InChI=1S/C10H12F2N2O/c11-9(12)5-15-10-7-3-1-2-4-8(7)13-6-14-10/h6,9H,1-5H2 |
| InChIKey | AQLNBKHHNJGAMF-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |