About 7-(cyclopropylmethoxy)-2,5-dimethylpyrazolo[1,5-a]pyrimidine
7-(cyclopropylmethoxy)-2,5-dimethylpyrazolo[1,5-a]pyrimidine (PubChem CID 126954741) has the molecular formula C12H15N3O
and a molecular weight of 217.27 g/mol. Its IUPAC name is 7-(cyclopropylmethoxy)-2,5-dimethylpyrazolo[1,5-a]pyrimidine.
Molecular Properties
| Compound Name | 7-(cyclopropylmethoxy)-2,5-dimethylpyrazolo[1,5-a]pyrimidine |
| PubChem CID | 126954741 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 7-(cyclopropylmethoxy)-2,5-dimethylpyrazolo[1,5-a]pyrimidine |
| SMILES | Cc1cc(OCC2CC2)n2nc(C)cc2n1 |
| InChI | InChI=1S/C12H15N3O/c1-8-6-12(16-7-10-3-4-10)15-11(13-8)5-9(2)14-15/h5-6,10H,3-4,7H2,1-2H3 |
| InChIKey | NROMRGBMWLBBQT-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-(cyclopropylmethoxy)-2,5-dimethylpyrazolo[1,5-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(cyclopropylmethoxy)-2,5-dimethylpyrazolo[1,5-a]pyrimidine?
The IUPAC name of 7-(cyclopropylmethoxy)-2,5-dimethylpyrazolo[1,5-a]pyrimidine (CID 126954741) is 7-(cyclopropylmethoxy)-2,5-dimethylpyrazolo[1,5-a]pyrimidine.
What is the SMILES notation for 7-(cyclopropylmethoxy)-2,5-dimethylpyrazolo[1,5-a]pyrimidine?
The canonical SMILES for 7-(cyclopropylmethoxy)-2,5-dimethylpyrazolo[1,5-a]pyrimidine is Cc1cc(OCC2CC2)n2nc(C)cc2n1.
What is the InChIKey of 7-(cyclopropylmethoxy)-2,5-dimethylpyrazolo[1,5-a]pyrimidine?
The InChIKey is NROMRGBMWLBBQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O/c1-8-6-12(16-7-10-3-4-10)15-11(13-8)5-9(2)14-15/h5-6,10H,3-4,7H2,1-2H3.
What are the key properties of 7-(cyclopropylmethoxy)-2,5-dimethylpyrazolo[1,5-a]pyrimidine?
7-(cyclopropylmethoxy)-2,5-dimethylpyrazolo[1,5-a]pyrimidine has a molecular weight of 217.27 g/mol, XLogP of 2.13, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(cyclopropylmethoxy)-2,5-dimethylpyrazolo[1,5-a]pyrimidine is sourced from PubChem (CID 126954741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).