About 2-(2-isoquinolin-2-ium-2-ylethoxy)isoindole-1,3-dione;hydrobromide
2-(2-isoquinolin-2-ium-2-ylethoxy)isoindole-1,3-dione;hydrobromide (PubChem CID 126957590) has the molecular formula C19H16BrN2O3+
and a molecular weight of 400.25 g/mol. Its IUPAC name is 2-(2-isoquinolin-2-ium-2-ylethoxy)isoindole-1,3-dione;hydrobromide.
Molecular Properties
| Compound Name | 2-(2-isoquinolin-2-ium-2-ylethoxy)isoindole-1,3-dione;hydrobromide |
| PubChem CID | 126957590 |
| Molecular Formula | C19H16BrN2O3+ |
| Molecular Weight | 400.25 g/mol |
| Exact Mass | 399.03 |
| IUPAC Name | 2-(2-isoquinolin-2-ium-2-ylethoxy)isoindole-1,3-dione;hydrobromide |
| SMILES | Br.O=C1c2ccccc2C(=O)N1OCC[n+]1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H15N2O3.BrH/c22-18-16-7-3-4-8-17(16)19(23)21(18)24-12-11-20-10-9-14-5-1-2-6-15(14)13-20;/h1-10,13H,11-12H2;1H/q+1; |
| InChIKey | QNYNOOPPVBSWKN-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 50.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.25 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-isoquinolin-2-ium-2-ylethoxy)isoindole-1,3-dione;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-isoquinolin-2-ium-2-ylethoxy)isoindole-1,3-dione;hydrobromide?
The IUPAC name of 2-(2-isoquinolin-2-ium-2-ylethoxy)isoindole-1,3-dione;hydrobromide (CID 126957590) is 2-(2-isoquinolin-2-ium-2-ylethoxy)isoindole-1,3-dione;hydrobromide.
What is the SMILES notation for 2-(2-isoquinolin-2-ium-2-ylethoxy)isoindole-1,3-dione;hydrobromide?
The canonical SMILES for 2-(2-isoquinolin-2-ium-2-ylethoxy)isoindole-1,3-dione;hydrobromide is Br.O=C1c2ccccc2C(=O)N1OCC[n+]1ccc2ccccc2c1.
What is the InChIKey of 2-(2-isoquinolin-2-ium-2-ylethoxy)isoindole-1,3-dione;hydrobromide?
The InChIKey is QNYNOOPPVBSWKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15N2O3.BrH/c22-18-16-7-3-4-8-17(16)19(23)21(18)24-12-11-20-10-9-14-5-1-2-6-15(14)13-20;/h1-10,13H,11-12H2;1H/q+1;.
What are the key properties of 2-(2-isoquinolin-2-ium-2-ylethoxy)isoindole-1,3-dione;hydrobromide?
2-(2-isoquinolin-2-ium-2-ylethoxy)isoindole-1,3-dione;hydrobromide has a molecular weight of 400.25 g/mol, XLogP of 2.93, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-isoquinolin-2-ium-2-ylethoxy)isoindole-1,3-dione;hydrobromide is sourced from PubChem (CID 126957590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).