About (2S)-1,2-dimethylaziridine
(2S)-1,2-dimethylaziridine (PubChem CID 12695792) has the molecular formula C4H9N
and a molecular weight of 71.12 g/mol. Its IUPAC name is (2S)-1,2-dimethylaziridine.
Molecular Properties
| Compound Name | (2S)-1,2-dimethylaziridine |
| PubChem CID | 12695792 |
| Molecular Formula | C4H9N |
| Molecular Weight | 71.12 g/mol |
| Exact Mass | 71.07 |
| IUPAC Name | (2S)-1,2-dimethylaziridine |
| SMILES | C[C@H]1CN1C |
| InChI | InChI=1S/C4H9N/c1-4-3-5(4)2/h4H,3H2,1-2H3/t4-,5?/m0/s1 |
| InChIKey | LDUKCCKFNKIVMS-ROLXFIACSA-N |
| XLogP | 0.32 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 71.12 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (2S)-1,2-dimethylaziridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1,2-dimethylaziridine?
The IUPAC name of (2S)-1,2-dimethylaziridine (CID 12695792) is (2S)-1,2-dimethylaziridine.
What is the SMILES notation for (2S)-1,2-dimethylaziridine?
The canonical SMILES for (2S)-1,2-dimethylaziridine is C[C@H]1CN1C.
What is the InChIKey of (2S)-1,2-dimethylaziridine?
The InChIKey is LDUKCCKFNKIVMS-ROLXFIACSA-N. The full InChI is InChI=1S/C4H9N/c1-4-3-5(4)2/h4H,3H2,1-2H3/t4-,5?/m0/s1.
What are the key properties of (2S)-1,2-dimethylaziridine?
(2S)-1,2-dimethylaziridine has a molecular weight of 71.12 g/mol, XLogP of 0.32, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1,2-dimethylaziridine is sourced from PubChem (CID 12695792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).