About [(4Z)-cyclooct-4-en-1-yl]-trimethylazanium;hydroiodide
[(4Z)-cyclooct-4-en-1-yl]-trimethylazanium;hydroiodide (PubChem CID 126958977) has the molecular formula C11H23IN+
and a molecular weight of 296.22 g/mol. Its IUPAC name is [(4Z)-cyclooct-4-en-1-yl]-trimethylazanium;hydroiodide.
Molecular Properties
| Compound Name | [(4Z)-cyclooct-4-en-1-yl]-trimethylazanium;hydroiodide |
| PubChem CID | 126958977 |
| Molecular Formula | C11H23IN+ |
| Molecular Weight | 296.22 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | [(4Z)-cyclooct-4-en-1-yl]-trimethylazanium;hydroiodide |
| SMILES | C[N+](C)(C)C1CC/C=C\CCC1.I |
| InChI | InChI=1S/C11H22N.HI/c1-12(2,3)11-9-7-5-4-6-8-10-11;/h4-5,11H,6-10H2,1-3H3;1H/q+1;/b5-4-; |
| InChIKey | MTIBMWLHKGTGCL-MKWAYWHRSA-N |
| XLogP | 3.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.22 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [(4Z)-cyclooct-4-en-1-yl]-trimethylazanium;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4Z)-cyclooct-4-en-1-yl]-trimethylazanium;hydroiodide?
The IUPAC name of [(4Z)-cyclooct-4-en-1-yl]-trimethylazanium;hydroiodide (CID 126958977) is [(4Z)-cyclooct-4-en-1-yl]-trimethylazanium;hydroiodide.
What is the SMILES notation for [(4Z)-cyclooct-4-en-1-yl]-trimethylazanium;hydroiodide?
The canonical SMILES for [(4Z)-cyclooct-4-en-1-yl]-trimethylazanium;hydroiodide is C[N+](C)(C)C1CC/C=C\CCC1.I.
What is the InChIKey of [(4Z)-cyclooct-4-en-1-yl]-trimethylazanium;hydroiodide?
The InChIKey is MTIBMWLHKGTGCL-MKWAYWHRSA-N. The full InChI is InChI=1S/C11H22N.HI/c1-12(2,3)11-9-7-5-4-6-8-10-11;/h4-5,11H,6-10H2,1-3H3;1H/q+1;/b5-4-;.
What are the key properties of [(4Z)-cyclooct-4-en-1-yl]-trimethylazanium;hydroiodide?
[(4Z)-cyclooct-4-en-1-yl]-trimethylazanium;hydroiodide has a molecular weight of 296.22 g/mol, XLogP of 3.20, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(4Z)-cyclooct-4-en-1-yl]-trimethylazanium;hydroiodide is sourced from PubChem (CID 126958977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).