C19H19BrNO+ — CID 126959105
2-(3,5-dimethylpyridin-1-ium-1-yl)-1-naphthalen-1-ylethanone;hydrobromide (PubChem CID 126959105) has the molecular formula C19H19BrNO+ and a molecular weight of 357.27 g/mol. Its IUPAC name is 2-(3,5-dimethylpyridin-1-ium-1-yl)-1-naphthalen-1-ylethanone;hydrobromide.
| Compound Name | 2-(3,5-dimethylpyridin-1-ium-1-yl)-1-naphthalen-1-ylethanone;hydrobromide |
|---|---|
| PubChem CID | 126959105 |
| Molecular Formula | C19H19BrNO+ |
| Molecular Weight | 357.27 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | 2-(3,5-dimethylpyridin-1-ium-1-yl)-1-naphthalen-1-ylethanone;hydrobromide |
| SMILES | Br.Cc1cc(C)c[n+](CC(=O)c2cccc3ccccc23)c1 |
| InChI | InChI=1S/C19H18NO.BrH/c1-14-10-15(2)12-20(11-14)13-19(21)18-9-5-7-16-6-3-4-8-17(16)18;/h3-12H,13H2,1-2H3;1H/q+1; |
| InChIKey | ZUUGPDSDEAFHDO-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 20.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.27 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|