C28H24INOPS+ — CID 126959158
(5-methylsulfanyl-2-phenyl-1,3-oxazol-4-yl)-triphenylphosphanium;hydroiodide (PubChem CID 126959158) has the molecular formula C28H24INOPS+ and a molecular weight of 580.45 g/mol. Its IUPAC name is (5-methylsulfanyl-2-phenyl-1,3-oxazol-4-yl)-triphenylphosphanium;hydroiodide.
| Compound Name | (5-methylsulfanyl-2-phenyl-1,3-oxazol-4-yl)-triphenylphosphanium;hydroiodide |
|---|---|
| PubChem CID | 126959158 |
| Molecular Formula | C28H24INOPS+ |
| Molecular Weight | 580.45 g/mol |
| Exact Mass | 580.04 |
| IUPAC Name | (5-methylsulfanyl-2-phenyl-1,3-oxazol-4-yl)-triphenylphosphanium;hydroiodide |
| SMILES | CSc1oc(-c2ccccc2)nc1[P+](c1ccccc1)(c1ccccc1)c1ccccc1.I |
| InChI | InChI=1S/C28H23NOPS.HI/c1-32-28-27(29-26(30-28)22-14-6-2-7-15-22)31(23-16-8-3-9-17-23,24-18-10-4-11-19-24)25-20-12-5-13-21-25;/h2-21H,1H3;1H/q+1; |
| InChIKey | AZVWBBMEVMSBQB-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.45 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|