About (2,2-dimethylpropanoylamino)methyl-triphenylphosphanium;hydrochloride
(2,2-dimethylpropanoylamino)methyl-triphenylphosphanium;hydrochloride (PubChem CID 126959458) has the molecular formula C24H28ClNOP+
and a molecular weight of 412.92 g/mol. Its IUPAC name is (2,2-dimethylpropanoylamino)methyl-triphenylphosphanium;hydrochloride.
Molecular Properties
| Compound Name | (2,2-dimethylpropanoylamino)methyl-triphenylphosphanium;hydrochloride |
| PubChem CID | 126959458 |
| Molecular Formula | C24H28ClNOP+ |
| Molecular Weight | 412.92 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | (2,2-dimethylpropanoylamino)methyl-triphenylphosphanium;hydrochloride |
| SMILES | CC(C)(C)C(=O)NC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C24H26NOP.ClH/c1-24(2,3)23(26)25-19-27(20-13-7-4-8-14-20,21-15-9-5-10-16-21)22-17-11-6-12-18-22;/h4-18H,19H2,1-3H3;1H/p+1 |
| InChIKey | HJQLZRPRSHLGBT-UHFFFAOYSA-O |
| XLogP | 4.52 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.92 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2,2-dimethylpropanoylamino)methyl-triphenylphosphanium;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,2-dimethylpropanoylamino)methyl-triphenylphosphanium;hydrochloride?
The IUPAC name of (2,2-dimethylpropanoylamino)methyl-triphenylphosphanium;hydrochloride (CID 126959458) is (2,2-dimethylpropanoylamino)methyl-triphenylphosphanium;hydrochloride.
What is the SMILES notation for (2,2-dimethylpropanoylamino)methyl-triphenylphosphanium;hydrochloride?
The canonical SMILES for (2,2-dimethylpropanoylamino)methyl-triphenylphosphanium;hydrochloride is CC(C)(C)C(=O)NC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.Cl.
What is the InChIKey of (2,2-dimethylpropanoylamino)methyl-triphenylphosphanium;hydrochloride?
The InChIKey is HJQLZRPRSHLGBT-UHFFFAOYSA-O. The full InChI is InChI=1S/C24H26NOP.ClH/c1-24(2,3)23(26)25-19-27(20-13-7-4-8-14-20,21-15-9-5-10-16-21)22-17-11-6-12-18-22;/h4-18H,19H2,1-3H3;1H/p+1.
What are the key properties of (2,2-dimethylpropanoylamino)methyl-triphenylphosphanium;hydrochloride?
(2,2-dimethylpropanoylamino)methyl-triphenylphosphanium;hydrochloride has a molecular weight of 412.92 g/mol, XLogP of 4.52, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2-dimethylpropanoylamino)methyl-triphenylphosphanium;hydrochloride is sourced from PubChem (CID 126959458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).