About [2-(3,4-dichlorophenyl)-2-hydroxyethyl]-dimethyl-propan-2-ylazanium;hydroiodide
[2-(3,4-dichlorophenyl)-2-hydroxyethyl]-dimethyl-propan-2-ylazanium;hydroiodide (PubChem CID 126959899) has the molecular formula C13H21Cl2INO+
and a molecular weight of 405.13 g/mol. Its IUPAC name is [2-(3,4-dichlorophenyl)-2-hydroxyethyl]-dimethyl-propan-2-ylazanium;hydroiodide.
Molecular Properties
| Compound Name | [2-(3,4-dichlorophenyl)-2-hydroxyethyl]-dimethyl-propan-2-ylazanium;hydroiodide |
| PubChem CID | 126959899 |
| Molecular Formula | C13H21Cl2INO+ |
| Molecular Weight | 405.13 g/mol |
| Exact Mass | 404.00 |
| IUPAC Name | [2-(3,4-dichlorophenyl)-2-hydroxyethyl]-dimethyl-propan-2-ylazanium;hydroiodide |
| SMILES | CC(C)[N+](C)(C)CC(O)c1ccc(Cl)c(Cl)c1.I |
| InChI | InChI=1S/C13H20Cl2NO.HI/c1-9(2)16(3,4)8-13(17)10-5-6-11(14)12(15)7-10;/h5-7,9,13,17H,8H2,1-4H3;1H/q+1; |
| InChIKey | KQYFYSURCNOUBL-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.13 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [2-(3,4-dichlorophenyl)-2-hydroxyethyl]-dimethyl-propan-2-ylazanium;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3,4-dichlorophenyl)-2-hydroxyethyl]-dimethyl-propan-2-ylazanium;hydroiodide?
The IUPAC name of [2-(3,4-dichlorophenyl)-2-hydroxyethyl]-dimethyl-propan-2-ylazanium;hydroiodide (CID 126959899) is [2-(3,4-dichlorophenyl)-2-hydroxyethyl]-dimethyl-propan-2-ylazanium;hydroiodide.
What is the SMILES notation for [2-(3,4-dichlorophenyl)-2-hydroxyethyl]-dimethyl-propan-2-ylazanium;hydroiodide?
The canonical SMILES for [2-(3,4-dichlorophenyl)-2-hydroxyethyl]-dimethyl-propan-2-ylazanium;hydroiodide is CC(C)[N+](C)(C)CC(O)c1ccc(Cl)c(Cl)c1.I.
What is the InChIKey of [2-(3,4-dichlorophenyl)-2-hydroxyethyl]-dimethyl-propan-2-ylazanium;hydroiodide?
The InChIKey is KQYFYSURCNOUBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20Cl2NO.HI/c1-9(2)16(3,4)8-13(17)10-5-6-11(14)12(15)7-10;/h5-7,9,13,17H,8H2,1-4H3;1H/q+1;.
What are the key properties of [2-(3,4-dichlorophenyl)-2-hydroxyethyl]-dimethyl-propan-2-ylazanium;hydroiodide?
[2-(3,4-dichlorophenyl)-2-hydroxyethyl]-dimethyl-propan-2-ylazanium;hydroiodide has a molecular weight of 405.13 g/mol, XLogP of 4.13, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3,4-dichlorophenyl)-2-hydroxyethyl]-dimethyl-propan-2-ylazanium;hydroiodide is sourced from PubChem (CID 126959899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).