About (1-acetamido-2,2-dichloroethenyl)-triphenylphosphanium;hydroiodide
(1-acetamido-2,2-dichloroethenyl)-triphenylphosphanium;hydroiodide (PubChem CID 126960209) has the molecular formula C22H20Cl2INOP+
and a molecular weight of 543.19 g/mol. Its IUPAC name is (1-acetamido-2,2-dichloroethenyl)-triphenylphosphanium;hydroiodide.
Molecular Properties
| Compound Name | (1-acetamido-2,2-dichloroethenyl)-triphenylphosphanium;hydroiodide |
| PubChem CID | 126960209 |
| Molecular Formula | C22H20Cl2INOP+ |
| Molecular Weight | 543.19 g/mol |
| Exact Mass | 541.97 |
| IUPAC Name | (1-acetamido-2,2-dichloroethenyl)-triphenylphosphanium;hydroiodide |
| SMILES | CC(=O)NC(=C(Cl)Cl)[P+](c1ccccc1)(c1ccccc1)c1ccccc1.I |
| InChI | InChI=1S/C22H18Cl2NOP.HI/c1-17(26)25-22(21(23)24)27(18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20;/h2-16H,1H3;1H/p+1 |
| InChIKey | PJZRSNUCJQONMR-UHFFFAOYSA-O |
| XLogP | 5.34 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 543.19 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (1-acetamido-2,2-dichloroethenyl)-triphenylphosphanium;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-acetamido-2,2-dichloroethenyl)-triphenylphosphanium;hydroiodide?
The IUPAC name of (1-acetamido-2,2-dichloroethenyl)-triphenylphosphanium;hydroiodide (CID 126960209) is (1-acetamido-2,2-dichloroethenyl)-triphenylphosphanium;hydroiodide.
What is the SMILES notation for (1-acetamido-2,2-dichloroethenyl)-triphenylphosphanium;hydroiodide?
The canonical SMILES for (1-acetamido-2,2-dichloroethenyl)-triphenylphosphanium;hydroiodide is CC(=O)NC(=C(Cl)Cl)[P+](c1ccccc1)(c1ccccc1)c1ccccc1.I.
What is the InChIKey of (1-acetamido-2,2-dichloroethenyl)-triphenylphosphanium;hydroiodide?
The InChIKey is PJZRSNUCJQONMR-UHFFFAOYSA-O. The full InChI is InChI=1S/C22H18Cl2NOP.HI/c1-17(26)25-22(21(23)24)27(18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20;/h2-16H,1H3;1H/p+1.
What are the key properties of (1-acetamido-2,2-dichloroethenyl)-triphenylphosphanium;hydroiodide?
(1-acetamido-2,2-dichloroethenyl)-triphenylphosphanium;hydroiodide has a molecular weight of 543.19 g/mol, XLogP of 5.34, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1-acetamido-2,2-dichloroethenyl)-triphenylphosphanium;hydroiodide is sourced from PubChem (CID 126960209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).