C10Cl2F8 — CID 12696022
1,2-dichloro-1,3,4,4,5,6,7,8-octafluoronaphthalene (PubChem CID 12696022) has the molecular formula C10Cl2F8 and a molecular weight of 343.00 g/mol. Its IUPAC name is 1,2-dichloro-1,3,4,4,5,6,7,8-octafluoronaphthalene.
| Compound Name | 1,2-dichloro-1,3,4,4,5,6,7,8-octafluoronaphthalene |
|---|---|
| PubChem CID | 12696022 |
| Molecular Formula | C10Cl2F8 |
| Molecular Weight | 343.00 g/mol |
| Exact Mass | 341.92 |
| IUPAC Name | 1,2-dichloro-1,3,4,4,5,6,7,8-octafluoronaphthalene |
| SMILES | FC1=C(Cl)C(F)(Cl)c2c(F)c(F)c(F)c(F)c2C1(F)F |
| InChI | InChI=1S/C10Cl2F8/c11-7-8(17)10(19,20)2-1(9(7,12)18)3(13)5(15)6(16)4(2)14 |
| InChIKey | LSSUPAHSARIMRM-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.00 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|