C10Cl6F4 — CID 12696023
1,1,2,3,4,4-hexachloro-5,6,7,8-tetrafluoronaphthalene (PubChem CID 12696023) has the molecular formula C10Cl6F4 and a molecular weight of 408.82 g/mol. Its IUPAC name is 1,1,2,3,4,4-hexachloro-5,6,7,8-tetrafluoronaphthalene.
| Compound Name | 1,1,2,3,4,4-hexachloro-5,6,7,8-tetrafluoronaphthalene |
|---|---|
| PubChem CID | 12696023 |
| Molecular Formula | C10Cl6F4 |
| Molecular Weight | 408.82 g/mol |
| Exact Mass | 405.81 |
| IUPAC Name | 1,1,2,3,4,4-hexachloro-5,6,7,8-tetrafluoronaphthalene |
| SMILES | Fc1c(F)c(F)c2c(c1F)C(Cl)(Cl)C(Cl)=C(Cl)C2(Cl)Cl |
| InChI | InChI=1S/C10Cl6F4/c11-7-8(12)10(15,16)2-1(9(7,13)14)3(17)5(19)6(20)4(2)18 |
| InChIKey | WCWDOECESNFGPY-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.82 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|