About 2-ethylisoquinolin-2-ium;hydroiodide
2-ethylisoquinolin-2-ium;hydroiodide (PubChem CID 126960238) has the molecular formula C11H13IN+
and a molecular weight of 286.14 g/mol. Its IUPAC name is 2-ethylisoquinolin-2-ium;hydroiodide.
Molecular Properties
| Compound Name | 2-ethylisoquinolin-2-ium;hydroiodide |
| PubChem CID | 126960238 |
| Molecular Formula | C11H13IN+ |
| Molecular Weight | 286.14 g/mol |
| Exact Mass | 286.01 |
| IUPAC Name | 2-ethylisoquinolin-2-ium;hydroiodide |
| SMILES | CC[n+]1ccc2ccccc2c1.I |
| InChI | InChI=1S/C11H12N.HI/c1-2-12-8-7-10-5-3-4-6-11(10)9-12;/h3-9H,2H2,1H3;1H/q+1; |
| InChIKey | OSXJIDNUDPMUBP-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.14 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylisoquinolin-2-ium;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylisoquinolin-2-ium;hydroiodide?
The IUPAC name of 2-ethylisoquinolin-2-ium;hydroiodide (CID 126960238) is 2-ethylisoquinolin-2-ium;hydroiodide.
What is the SMILES notation for 2-ethylisoquinolin-2-ium;hydroiodide?
The canonical SMILES for 2-ethylisoquinolin-2-ium;hydroiodide is CC[n+]1ccc2ccccc2c1.I.
What is the InChIKey of 2-ethylisoquinolin-2-ium;hydroiodide?
The InChIKey is OSXJIDNUDPMUBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N.HI/c1-2-12-8-7-10-5-3-4-6-11(10)9-12;/h3-9H,2H2,1H3;1H/q+1;.
What are the key properties of 2-ethylisoquinolin-2-ium;hydroiodide?
2-ethylisoquinolin-2-ium;hydroiodide has a molecular weight of 286.14 g/mol, XLogP of 2.77, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylisoquinolin-2-ium;hydroiodide is sourced from PubChem (CID 126960238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).