C7H9ClO2 — CID 126961013
(1R,2S)-5-chloro-3-methylcyclohexa-3,5-diene-1,2-diol (PubChem CID 126961013) has the molecular formula C7H9ClO2 and a molecular weight of 160.60 g/mol. Its IUPAC name is (1R,2S)-5-chloro-3-methylcyclohexa-3,5-diene-1,2-diol.
| Compound Name | (1R,2S)-5-chloro-3-methylcyclohexa-3,5-diene-1,2-diol |
|---|---|
| PubChem CID | 126961013 |
| Molecular Formula | C7H9ClO2 |
| Molecular Weight | 160.60 g/mol |
| Exact Mass | 160.03 |
| IUPAC Name | (1R,2S)-5-chloro-3-methylcyclohexa-3,5-diene-1,2-diol |
| SMILES | CC1=CC(Cl)=C[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C7H9ClO2/c1-4-2-5(8)3-6(9)7(4)10/h2-3,6-7,9-10H,1H3/t6-,7+/m1/s1 |
| InChIKey | NNJPFUSOJVYIKX-RQJHMYQMSA-N |
| XLogP | 0.79 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.60 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |