C18H25NO6-2 — CID 126961097
(2S,3S)-2-[[2-[(1R,2S)-2-[(Z)-4-carboxylatobut-2-enyl]-3-oxocyclopentyl]acetyl]amino]-3-methylpentanoate (PubChem CID 126961097) has the molecular formula C18H25NO6-2 and a molecular weight of 351.40 g/mol. Its IUPAC name is (2S,3S)-2-[[2-[(1R,2S)-2-[(Z)-4-carboxylatobut-2-enyl]-3-oxocyclopentyl]acetyl]amino]-3-methylpentanoate.
| Compound Name | (2S,3S)-2-[[2-[(1R,2S)-2-[(Z)-4-carboxylatobut-2-enyl]-3-oxocyclopentyl]acetyl]amino]-3-methylpentanoate |
|---|---|
| PubChem CID | 126961097 |
| Molecular Formula | C18H25NO6-2 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | (2S,3S)-2-[[2-[(1R,2S)-2-[(Z)-4-carboxylatobut-2-enyl]-3-oxocyclopentyl]acetyl]amino]-3-methylpentanoate |
| SMILES | CC[C@H](C)[C@H](NC(=O)C[C@H]1CCC(=O)[C@H]1C/C=C\CC(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C18H27NO6/c1-3-11(2)17(18(24)25)19-15(21)10-12-8-9-14(20)13(12)6-4-5-7-16(22)23/h4-5,11-13,17H,3,6-10H2,1-2H3,(H,19,21)(H,22,23)(H,24,25)/p-2/b5-4-/t11-,12+,13-,17-/m0/s1 |
| InChIKey | JGWHHQHWBOQVJU-SIEWLTCVSA-L |
| XLogP | -0.66 |
| TPSA | 126.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|