C21H29O5- — CID 126961100
(4R)-4,5-dihydroxy-2-(2-methylbutanoyl)-4,6-bis(3-methylbut-2-enyl)-3-oxocyclohexa-1,5-dien-1-olate (PubChem CID 126961100) has the molecular formula C21H29O5- and a molecular weight of 361.46 g/mol. Its IUPAC name is (4R)-4,5-dihydroxy-2-(2-methylbutanoyl)-4,6-bis(3-methylbut-2-enyl)-3-oxocyclohexa-1,5-dien-1-olate.
| Compound Name | (4R)-4,5-dihydroxy-2-(2-methylbutanoyl)-4,6-bis(3-methylbut-2-enyl)-3-oxocyclohexa-1,5-dien-1-olate |
|---|---|
| PubChem CID | 126961100 |
| Molecular Formula | C21H29O5- |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | (4R)-4,5-dihydroxy-2-(2-methylbutanoyl)-4,6-bis(3-methylbut-2-enyl)-3-oxocyclohexa-1,5-dien-1-olate |
| SMILES | CCC(C)C(=O)C1=C([O-])C(CC=C(C)C)=C(O)[C@](O)(CC=C(C)C)C1=O |
| InChI | InChI=1S/C21H30O5/c1-7-14(6)17(22)16-18(23)15(9-8-12(2)3)19(24)21(26,20(16)25)11-10-13(4)5/h8,10,14,23-24,26H,7,9,11H2,1-6H3/p-1/t14?,21-/m1/s1 |
| InChIKey | LDXMPKMQIKGJFN-OKKPIIHCSA-M |
| XLogP | 3.05 |
| TPSA | 97.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|