C31H30F2N2O5 — CID 126961575
(2S)-7-[4-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]butoxy]-2-(4-fluorophenyl)-5-hydroxy-2,3-dihydrochromen-4-one (PubChem CID 126961575) has the molecular formula C31H30F2N2O5 and a molecular weight of 548.59 g/mol. Its IUPAC name is (2S)-7-[4-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]butoxy]-2-(4-fluorophenyl)-5-hydroxy-2,3-dihydrochromen-4-one.
| Compound Name | (2S)-7-[4-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]butoxy]-2-(4-fluorophenyl)-5-hydroxy-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 126961575 |
| Molecular Formula | C31H30F2N2O5 |
| Molecular Weight | 548.59 g/mol |
| Exact Mass | 548.21 |
| IUPAC Name | (2S)-7-[4-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]butoxy]-2-(4-fluorophenyl)-5-hydroxy-2,3-dihydrochromen-4-one |
| SMILES | O=C1C[C@@H](c2ccc(F)cc2)Oc2cc(OCCCCN3CCC(c4noc5cc(F)ccc45)CC3)cc(O)c21 |
| InChI | InChI=1S/C31H30F2N2O5/c32-21-5-3-19(4-6-21)27-18-26(37)30-25(36)16-23(17-29(30)39-27)38-14-2-1-11-35-12-9-20(10-13-35)31-24-8-7-22(33)15-28(24)40-34-31/h3-8,15-17,20,27,36H,1-2,9-14,18H2/t27-/m0/s1 |
| InChIKey | KUOYFTRGKVRORO-MHZLTWQESA-N |
| XLogP | 6.56 |
| TPSA | 85.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.59 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|